Introduction:Basic information about CAS 1611-03-6|3,5-di-tert-butyl-4-hydroxyphenylacetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-di-tert-butyl-4-hydroxyphenylacetic acid |
|---|
| CAS Number | 1611-03-6 | Molecular Weight | 264.36000 |
|---|
| Density | 1.063g/cm3 | Boiling Point | 348.9ºC at 760mmHg |
|---|
| Molecular Formula | C16H24O3 | Melting Point | 157 °C |
|---|
| MSDS | / | Flash Point | 179ºC |
|---|
Names
| Name | 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.063g/cm3 |
|---|
| Boiling Point | 348.9ºC at 760mmHg |
|---|
| Melting Point | 157 °C |
|---|
| Molecular Formula | C16H24O3 |
|---|
| Molecular Weight | 264.36000 |
|---|
| Flash Point | 179ºC |
|---|
| Exact Mass | 264.17300 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 3.61430 |
|---|
| Vapour Pressure | 1.83E-05mmHg at 25°C |
|---|
| InChIKey | QLMGIWHWWWXXME-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc(CC(=O)O)cc(C(C)(C)C)c1O |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R61:May cause harm to the unborn child. R40:Limited evidence of a carcinogenic effect. |
|---|
| Safety Phrases | S53-S36/37/39-S45 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | BV8052000 |
|---|
| HS Code | 2918290000 |
|---|
Customs
| HS Code | 2918290000 |
|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3,5-di-tert-butyl-4-hydroxyphenyl acetic acid |
| 4-hydroxy-3,5-di-tert-butylphenylacetic acid |
| 3,5-di-t-butyl-4-hydroxyphenyl-acetic acid |
| MFCD00156138 |
| 2-[3,5-di(tert-butyl)-4-hydroxyphenyl]acetic acid |