Introduction:Basic information about CAS 16436-29-6|1-Hexanaminium, N,N,N-trihexyl-, benzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Hexanaminium, N,N,N-trihexyl-, benzoate |
|---|
| CAS Number | 16436-29-6 | Molecular Weight | 475.79000 |
|---|
| Density | 1 | Boiling Point | 575.47°C (rough estimate) |
|---|
| Molecular Formula | C31H57NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 86ºC |
|---|
Names
| Name | tetrahexylazanium,benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1 |
|---|
| Boiling Point | 575.47°C (rough estimate) |
|---|
| Molecular Formula | C31H57NO2 |
|---|
| Molecular Weight | 475.79000 |
|---|
| Flash Point | 86ºC |
|---|
| Exact Mass | 475.43900 |
|---|
| PSA | 40.13000 |
|---|
| LogP | 8.17450 |
|---|
| Index of Refraction | 1.478-1.48 |
|---|
| InChIKey | PSEQWFPWQRZBOO-UHFFFAOYSA-M |
|---|
| SMILES | CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC.O=C([O-])c1ccccc1 |
|---|
Safety Information
| Hazard Codes | F: Flammable;T: Toxic; |
|---|
| Risk Phrases | 11-23/24/25-39/23/24/25 |
|---|
| Safety Phrases | 7-16-36/37-45 |
|---|
| RIDADR | UN 1230 3/PG 2 |
|---|
| WGK Germany | 1 |
|---|
| HS Code | 2923900090 |
|---|
Customs
| HS Code | 2923900090 |
|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| THAB |
| tetrahexylazanium benzoate |
| EINECS 240-492-6 |
| tetrahexylammonium benzoate |
| Tetrahexylammonium benzoate solution |
| tetra-n-hexylammonium benzoate |
| 1-Hexanaminium,N,N,N-trihexyl-,benzoate |
| Tetra-n-hexylammoniumbenzoat |
| MFCD00041982 |
| Ammonium,benzoate |