Introduction:Basic information about CAS 16017-64-4|2-(4-TOSYLPIPERAZIN-1-YL)ETHANOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-TOSYLPIPERAZIN-1-YL)ETHANOL |
|---|
| CAS Number | 16017-64-4 | Molecular Weight | 284.37500 |
|---|
| Density | 1.251g/cm3 | Boiling Point | 452.3ºC at 760mmHg |
|---|
| Molecular Formula | C13H20N2O3S | Melting Point | 130-132ºC |
|---|
| MSDS | / | Flash Point | 227.3ºC |
|---|
Names
| Name | 2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.251g/cm3 |
|---|
| Boiling Point | 452.3ºC at 760mmHg |
|---|
| Melting Point | 130-132ºC |
|---|
| Molecular Formula | C13H20N2O3S |
|---|
| Molecular Weight | 284.37500 |
|---|
| Flash Point | 227.3ºC |
|---|
| Exact Mass | 284.11900 |
|---|
| PSA | 69.23000 |
|---|
| LogP | 1.25020 |
|---|
| Vapour Pressure | 5.72E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | GJAGYOKCNZTDQN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CCO)CC2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-Methyl-benzolsulfonsaeure-N'-(2-hydroxy-ethyl)-piperazid |
| 1-(2-Hydroxyethyl)-4-(toluol-4-sulfonyl)-piperazin |
| 2-[4-(toluene-4-sulfonyl)-piperazin-1-yl]-ethanol |
| 4-(2-hydroxyethyl)-1-[(4-methylphenyl)sulfonyl]piperazine |
| 2-{4-[(4-Methylphenyl)Sulfonyl]-1-Piperazinyl}Ethanol |
| 1-piperazineethanol,4-[(4-methylphenyl)sulfonyl] |
| 1-(2-hydroxy-ethyl)-4-(toluene-4-sulfonyl)-piperazine |
| F1452-0059 |
| 2-(4-tosylpiperazin-1-yl)ethanol |