Introduction:Basic information about CAS 25589-41-7|4-[(4-bromophenyl)amino]-4-oxobutanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(4-bromophenyl)amino]-4-oxobutanoic acid |
|---|
| CAS Number | 25589-41-7 | Molecular Weight | 272.09500 |
|---|
| Density | 1.635g/cm3 | Boiling Point | 501.1ºC at 760 mmHg |
|---|
| Molecular Formula | C10H10BrNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 256.8ºC |
|---|
Names
| Name | 4-(4-bromoanilino)-4-oxobutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.635g/cm3 |
|---|
| Boiling Point | 501.1ºC at 760 mmHg |
|---|
| Molecular Formula | C10H10BrNO3 |
|---|
| Molecular Weight | 272.09500 |
|---|
| Flash Point | 256.8ºC |
|---|
| Exact Mass | 270.98400 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 2.32540 |
|---|
| Vapour Pressure | 7.35E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | MJQBQVIGARYLLU-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCC(=O)Nc1ccc(Br)cc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3-[(4-bromophenyl)carbamoyl]propanoic acid |
| succinic acid mono-4-bromoanilide |
| Bernsteinsaeure-mono-(4-brom-anilid) |
| Butanoic acid,4-[(4-bromophenyl)amino]-4-oxo |
| 4-((4-bromophenyl)amino)-4-oxobutanoic acid |
| N-(4-Brom-phenyl)-succinamidsaeure |
| N-(4-bromo-phenyl)-succinamic acid |
| 4-Brom-succinanilsaeure |