Introduction：Basic information about CAS 6154-38-7|Z-Gly-Asp-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Gly-Asp-OH |
|---|
| CAS Number | 6154-38-7 | Molecular Weight | 324.28600 |
|---|
| Density | 1.415g/cm3 | Boiling Point | 620.6ºC at 760 mmHg |
|---|
| Molecular Formula | C14H16N2O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 329.1ºC |
|---|
Names
| Name | 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]butanedioic acid |
|---|
Chemical & Physical Properties
| Density | 1.415g/cm3 |
|---|
| Boiling Point | 620.6ºC at 760 mmHg |
|---|
| Molecular Formula | C14H16N2O7 |
|---|
| Molecular Weight | 324.28600 |
|---|
| Flash Point | 329.1ºC |
|---|
| Exact Mass | 324.09600 |
|---|
| PSA | 142.03000 |
|---|
| LogP | 0.73870 |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | WINDTKMAFAXPSY-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CC(NC(=O)CNC(=O)OCc1ccccc1)C(=O)O |
|---|
