Introduction：Basic information about CAS 160232-08-6|tert-Butyl [(1S,2R)-1-Benzyl-2-hydroxy-3-(isobutylamino)propyl]carbamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl [(1S,2R)-1-Benzyl-2-hydroxy-3-(isobutylamino)propyl]carbamate |
|---|
| CAS Number | 160232-08-6 | Molecular Weight | 336.469 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 484.7±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H32N2O3 | Melting Point | 112 °C |
|---|
| MSDS | / | Flash Point | 246.9±28.7 °C |
|---|
Names
| Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-(2-methylpropylamino)-1-phenylbutan-2-yl]carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 484.7±45.0 °C at 760 mmHg |
|---|
| Melting Point | 112 °C |
|---|
| Molecular Formula | C19H32N2O3 |
|---|
| Molecular Weight | 336.469 |
|---|
| Flash Point | 246.9±28.7 °C |
|---|
| Exact Mass | 336.241302 |
|---|
| PSA | 70.59000 |
|---|
| LogP | 4.00 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.512 |
|---|
| InChIKey | NVEPLQDORJSXRO-DLBZAZTESA-N |
|---|
| SMILES | CC(C)CNCC(O)C(Cc1ccccc1)NC(=O)OC(C)(C)C |
|---|
Synonyms
| [(1S,2R)-2-hydroxy-3-[(2-methylpropyl)amino]-1-(phenylmethyl)propyl]carbamic acid 1,1-dimethylethyl ester |
| ((1S,2R)-1-benzyl-3-isobutylamino-2-hydroxy-propyl)-carbamic acid tert-butyl ester |
| tert-Butyl [(1S,2R)-1-Benzyl-2-hydroxy-3-(isobutylamino)propyl]carbamate |
| [2(R)-hydroxy-3-[(2-methylpropyl)amino]-1(S)-(phenylmethyl)propyl]carbamic acid 1,1-dimethylethyl ester |
| (2R,3S)-3-tert-butoxycarbonylamino-1-isobutylamino-4-phenyl-2-butanol |
| Carbamic acid, N-[(1S,2R)-2-hydroxy-3-[(2-methylpropyl)amino]-1-(phenylmethyl)propyl]-, 1,1-dimethylethyl ester |
| tert-Butyl ((2S,3R)-3-hydroxy-4-(isobutylamino)-1-phenylbutan-2-yl)carbamate |
| (1S,2R)-(1-benzyl-2-hydroxy-3-isobutylaminopropyl)carbamic acid tert-butyl ester |
| [(1S,2R)-3-[(2-methylpropyl)amino]-2-hydroxy-1-(phenylmethyl)propyl]carbamic acid tert-butyl ester |
| tert-butyl [(2S,3R)-3-hydroxy-1-phenyl-4-(2-methylpropan-1-ylamino)butan-2-yl]carbamate |
| tert-Butyl [(2S,3R)-3-hydroxy-4-(isobutylamino)-1-phenylbutan-2-yl]carbamate |
| 2-Methyl-2-propanyl [(2S,3R)-3-hydroxy-4-(isobutylamino)-1-phenyl-2-butanyl]carbamate |
