Introduction:Basic information about CAS 166438-80-8|4-(4-METHYL-1,4-DIAZEPAN-1-YL)BENZONITRILE 97, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-METHYL-1,4-DIAZEPAN-1-YL)BENZONITRILE 97 |
|---|
| CAS Number | 166438-80-8 | Molecular Weight | 215.29400 |
|---|
| Density | 1.11g/cm3 | Boiling Point | 371.5ºC at 760mmHg |
|---|
| Molecular Formula | C13H17N3 | Melting Point | 92.5-94.5ºC |
|---|
| MSDS | / | Flash Point | 162ºC |
|---|
Names
| Name | 4-(4-methyl-1,4-diazepan-1-yl)benzonitrile |
|---|
Chemical & Physical Properties
| Density | 1.11g/cm3 |
|---|
| Boiling Point | 371.5ºC at 760mmHg |
|---|
| Melting Point | 92.5-94.5ºC |
|---|
| Molecular Formula | C13H17N3 |
|---|
| Molecular Weight | 215.29400 |
|---|
| Flash Point | 162ºC |
|---|
| Exact Mass | 215.14200 |
|---|
| PSA | 30.27000 |
|---|
| LogP | 1.70308 |
|---|
| Vapour Pressure | 1.03E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | LWRMQRYMWJWCLS-UHFFFAOYSA-N |
|---|
| SMILES | CN1CCCN(c2ccc(C#N)cc2)CC1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|