Introduction：Basic information about CAS 169674-34-4|Ethyl 5,6-difluoro-1H-indole-2-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 5,6-difluoro-1H-indole-2-carboxylate |
|---|
| CAS Number | 169674-34-4 | Molecular Weight | 225.191 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 351.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H9F2NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 166.2±26.5 °C |
|---|
Names
| Name | ethyl 5,6-difluoro-1H-indole-2-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 351.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H9F2NO2 |
|---|
| Molecular Weight | 225.191 |
|---|
| Flash Point | 166.2±26.5 °C |
|---|
| Exact Mass | 225.060135 |
|---|
| PSA | 42.09000 |
|---|
| LogP | 3.20 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | OVSOYWROLOCQIS-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc2cc(F)c(F)cc2[nH]1 |
|---|
Synonyms
| ethyl 5,6-difluoroindole-2-carboxylate |
| 5,6-Difluoro-2-indole carboxylic acid ether ester |
| Ethyl 5,6-difluoro-1H-indole-2-carboxylate |
| Ethyl 5,6-difluoro-2-indolecarboxylate |
| 1H-Indole-2-carboxylic acid, 5,6-difluoro-, ethyl ester |
