Introduction:Basic information about CAS 13784-61-7|2,2-bis[[(1-oxodecyl)oxy]methyl]-1,3-propanediyl didecanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2-bis[[(1-oxodecyl)oxy]methyl]-1,3-propanediyl didecanoate |
|---|
| CAS Number | 13784-61-7 | Molecular Weight | 753.14400 |
|---|
| Density | 0.959g/cm3 | Boiling Point | 737.1ºC at 760mmHg |
|---|
| Molecular Formula | C45H84O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 283.9ºC |
|---|
Names
| Name | [3-decanoyloxy-2,2-bis(decanoyloxymethyl)propyl] decanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.959g/cm3 |
|---|
| Boiling Point | 737.1ºC at 760mmHg |
|---|
| Molecular Formula | C45H84O8 |
|---|
| Molecular Weight | 753.14400 |
|---|
| Flash Point | 283.9ºC |
|---|
| Exact Mass | 752.61700 |
|---|
| PSA | 105.20000 |
|---|
| LogP | 12.70840 |
|---|
| Vapour Pressure | 1.37E-21mmHg at 25°C |
|---|
| Index of Refraction | 1.466 |
|---|
| InChIKey | MXNODNKXIIQMMI-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)(COC(=O)CCCCCCCCC)COC(=O)CCCCCCCCC |
|---|
Safety Information
Customs
| HS Code | 2915900090 |
|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| tetra-O-decanoyl-pentaerythritol |
| Pentaerythritol tetradecanoate |
| Decanoic acid,neopentanetetrayl ester |
| Tetra-O-decanoyl-pentaerythrit |
| Decanoic acid,2,2-bis[[(1-oxodecyl)oxy]methyl]-1,3-propanediyl ester |
| pentaerythrityl tetracaprate |
| Pentaerythritol tetracaprate |
| pentaerythritol tetracaproate |
| 2,2-bis[[(1-oxodecyl)oxy]methyl]-1,3-propanediyl didecanoate |