Introduction:Basic information about CAS 16264-08-7|9,10-DIHYDRO-4H-BENZO(4,5)CYCLOHEPTA(1,2-B)THIOPHEN-4-ONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9,10-DIHYDRO-4H-BENZO(4,5)CYCLOHEPTA(1,2-B)THIOPHEN-4-ONE |
|---|
| CAS Number | 16264-08-7 | Molecular Weight | 249.26600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H15N3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-[4-(4-nitrophenyl)piperazin-1-yl]ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C12H15N3O3 |
|---|
| Molecular Weight | 249.26600 |
|---|
| Exact Mass | 249.11100 |
|---|
| PSA | 69.37000 |
|---|
| LogP | 1.78940 |
|---|
| InChIKey | QUZMCJMGHMRZHA-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
|---|
Safety Information
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-(4-nitrophenyl)-1-acetylpiperazine |
| 1-(4-(4-nitrophenyl)piperazin-1-yl)ethanone |
| 1-acetyl-4-(4-nitrophenyl)-piperazine |
| 1-[4-(4-Nitrophenyl)piperazin-1-yl]ethan-1-one |
| 4-(4-Acetylpiperazinyl)-1-nitrobenzene |
| 1-[4-(4-Nitro-phenyl)-piperazinyl]-ethanone |