Introduction:Basic information about CAS 36150-06-8|Saxalin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Saxalin |
|---|
| CAS Number | 36150-06-8 | Molecular Weight | 322.740 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 531.2±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H15ClO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 275.1±30.1 °C |
|---|
Names
| Name | 4-(3-chloro-2-hydroxy-3-methylbutoxy)furo[3,2-g]chromen-7-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 531.2±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H15ClO5 |
|---|
| Molecular Weight | 322.740 |
|---|
| Flash Point | 275.1±30.1 °C |
|---|
| Exact Mass | 322.060791 |
|---|
| PSA | 72.81000 |
|---|
| LogP | 2.33 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.615 |
|---|
| InChIKey | QPHPWCUVCZXUEP-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(Cl)C(O)COc1c2ccoc2cc2oc(=O)ccc12 |
|---|
Synonyms
| 4-(3-Chloro-2-hydroxy-3-methylbutoxy)-7H-furo[3,2-g]chromen-7-one |
| (+/-)-Saxalin |
| 7H-Furo[3,2-g][1]benzopyran-7-one,4-(3-chloro-2-hydroxy-3-methylbutoxy) |
| 7H-Furo[3,2-g][1]benzopyran-7-one, 4-(3-chloro-2-hydroxy-3-methylbutoxy)- |
| 4-(3-Chlor-2-hydroxy-3-methyl-butoxy)-furo[3,2-g]chromen-7-on |
| 4-(3-chloro-2-hydroxy-3-methyl-butoxy)-furo[3,2-g]chromen-7-one |
| Saxalin |