Introduction：Basic information about CAS 58580-09-9|2,3-Diamino-5-bromobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3-Diamino-5-bromobenzoic acid |
|---|
| CAS Number | 58580-09-9 | Molecular Weight | 231.047 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 403.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H7BrN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 197.6±28.7 °C |
|---|
Names
| Name | 5-bromo-2,3-phenylenediamine carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 403.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H7BrN2O2 |
|---|
| Molecular Weight | 231.047 |
|---|
| Flash Point | 197.6±28.7 °C |
|---|
| Exact Mass | 229.969086 |
|---|
| PSA | 89.34000 |
|---|
| LogP | 2.05 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.737 |
|---|
| InChIKey | OJPFJANHNZVEIL-UHFFFAOYSA-N |
|---|
| SMILES | Cl.Cl.Nc1cc(Br)cc(C(=O)O)c1N |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| 2,3-Diamino-5-bromobenzoic acid |
| Benzoic acid, 2,3-diamino-5-bromo- |
| 2,3-diamino-5-bromobenzoic acid dihydrochloride |
| 3-Chloro-6-(1-methyl-1H-pyrazol-4-yl)pyridazine |
