Introduction：Basic information about CAS 25570-02-9|3,3',5,5'-Tetramethylbiphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3',5,5'-Tetramethylbiphenyl |
|---|
| CAS Number | 25570-02-9 | Molecular Weight | 210.314 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 300.9±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H18 | Melting Point | 47-49ºC |
|---|
| MSDS | / | Flash Point | 138.7±17.2 °C |
|---|
Names
| Name | 1-(3,5-dimethylphenyl)-3,5-dimethylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 300.9±37.0 °C at 760 mmHg |
|---|
| Melting Point | 47-49ºC |
|---|
| Molecular Formula | C16H18 |
|---|
| Molecular Weight | 210.314 |
|---|
| Flash Point | 138.7±17.2 °C |
|---|
| Exact Mass | 210.140854 |
|---|
| LogP | 5.82 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.551 |
|---|
| InChIKey | CMZYGFLOKOQMKF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)cc(-c2cc(C)cc(C)c2)c1 |
|---|
Safety Information
| Safety Phrases | S22-S24/25 |
|---|
| HS Code | 2902909090 |
|---|
Customs
| HS Code | 2902909090 |
|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
Synonyms
| 3,5,3',5'-tetramethyl-2,2'-biphenyl |
| 3,3',5,5'-Tetramethylbenzidin |
| 3,3',5,5'-tetramethyl-1,1'-biphenyl |
| 3,5,3',5'-Tetramethylbiphenyl |
| 3,3',5,5'-tetramethyl biphenyl |
| 1,1'-Biphenyl,3,3',5,5'-tetramethyl |
| 1,1'-Biphenyl, 3,3',5,5'-tetramethyl- |
| 3,3',5,5'-Tetramethylbiphenyl |
| MFCD00051910 |
