Introduction：Basic information about CAS 1383624-01-8|6-chloro-2-(4-ethyl-3-nitrophenyl)imidazo[1,2-b]pyridazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-chloro-2-(4-ethyl-3-nitrophenyl)imidazo[1,2-b]pyridazine |
|---|
| CAS Number | 1383624-01-8 | Molecular Weight | 302.716 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C14H11ClN4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-chloro-2-(4-ethyl-3-nitrophenyl)imidazo[1,2-b]pyridazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Molecular Formula | C14H11ClN4O2 |
|---|
| Molecular Weight | 302.716 |
|---|
| Exact Mass | 302.057068 |
|---|
| PSA | 76.01000 |
|---|
| LogP | 3.30 |
|---|
| Index of Refraction | 1.697 |
|---|
| InChIKey | XDDKCUNEMDDJMN-UHFFFAOYSA-N |
|---|
| SMILES | CCc1ccc(-c2cn3nc(Cl)ccc3n2)cc1[N+](=O)[O-] |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| 6-Chloro-2-(4-ethyl-3-nitrophenyl)imidazo[1,2-b]pyridazine |
| Imidazo[1,2-b]pyridazine, 6-chloro-2-(4-ethyl-3-nitrophenyl)- |
