Introduction:Basic information about CAS 257616-46-9|4-(4-chlorophenoxy)-3-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-chlorophenoxy)-3-nitrobenzoic acid |
|---|
| CAS Number | 257616-46-9 | Molecular Weight | 293.65900 |
|---|
| Density | 1.495g/cm3 | Boiling Point | 437.4ºC at 760 mmHg |
|---|
| Molecular Formula | C13H8ClNO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 218.3ºC |
|---|
Names
| Name | 4-(4-chlorophenoxy)-3-nitrobenzoic acid |
|---|
Chemical & Physical Properties
| Density | 1.495g/cm3 |
|---|
| Boiling Point | 437.4ºC at 760 mmHg |
|---|
| Molecular Formula | C13H8ClNO5 |
|---|
| Molecular Weight | 293.65900 |
|---|
| Flash Point | 218.3ºC |
|---|
| Exact Mass | 293.00900 |
|---|
| PSA | 92.35000 |
|---|
| LogP | 4.26190 |
|---|
| Vapour Pressure | 2.01E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.643 |
|---|
| InChIKey | BQTVDXUJNBTHPV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(Oc2ccc(Cl)cc2)c([N+](=O)[O-])c1 |
|---|