Introduction：Basic information about CAS 255836-67-0|[1,1'-Binaphthalen]-2-yldi-tert-butylphosphine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [1,1'-Binaphthalen]-2-yldi-tert-butylphosphine |
|---|
| CAS Number | 255836-67-0 | Molecular Weight | 398.520 |
|---|
| Density | / | Boiling Point | 519.5±29.0 °C at 760 mmHg |
|---|
| Molecular Formula | C28H31P | Melting Point | 148-151ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 284.8±30.6 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | ditert-butyl-(1-naphthalen-1-ylnaphthalen-2-yl)phosphane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 519.5±29.0 °C at 760 mmHg |
|---|
| Melting Point | 148-151ºC |
|---|
| Molecular Formula | C28H31P |
|---|
| Molecular Weight | 398.520 |
|---|
| Flash Point | 284.8±30.6 °C |
|---|
| Exact Mass | 398.216339 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 9.24 |
|---|
| Appearance of Characters | crystal | white |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| InChIKey | QGBQGMHXBSLYLZ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)P(c1ccc2ccccc2c1-c1cccc2ccccc12)C(C)(C)C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 37/39-26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2902909090 |
|---|
Customs
| HS Code | 2902909090 |
|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
Synonyms
| racemic 2-(ditert-butylphosphino )-1,1'-binapthyl |
| racemic-2-Di-t-butylphosphino-1,1'-binaphthyl |
| 2-(Di-tert-butylphosphino)-1,1′-binaphthyl |
| TRIXIEPHOS |
| 2-(Di-tert-butylphosphino)-1,1‘-binaphthyl |
| rac-2-(Di-tert-butylphosphino)-1,1'-binaphthyl |
| 1,1'-Binaphthalen-2-yl[bis(2-methyl-2-propanyl)]phosphine |
| 2-[Di(tert-butyl)phosphino]-1,1'-binaphthyl |
| racemic-2-(di-tert-butylphosphino)-1,1'-binaphthyl |
| 2-(di-t-butylphosphino)-1,1'-binaphthyl |
| Phosphine, [1,1'-binaphthalen]-2-ylbis(1,1-dimethylethyl)- |
| [1,1'-Binaphthalen]-2-yldi-tert-butylphosphine |
| (binaphthyl)P(t-Bu)2 |
