Introduction：Basic information about CAS 16650-63-8|Methyl 3-bromo-1-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 3-bromo-1-naphthoate |
|---|
| CAS Number | 16650-63-8 | Molecular Weight | 265.103 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 353.9±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H9BrO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 167.9±20.4 °C |
|---|
Names
| Name | methyl 3-bromonaphthalene-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 353.9±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H9BrO2 |
|---|
| Molecular Weight | 265.103 |
|---|
| Flash Point | 167.9±20.4 °C |
|---|
| Exact Mass | 263.978577 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 4.11 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | BAIYNFZNNISXSV-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(Br)cc2ccccc12 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| 1-Naphthalenecarboxylic acid, 3-bromo-, methyl ester |
| 3-Brom-1-naphthoesaeure-methylester |
| methyl 3-bromo-1-naphthalenecarboxylate |
| AB1514 |
| Methyl 3-bromo-1-naphthoate |
| methyl 3-bromonaphthoate |
| 3-bromo-naphthalene-1-carboxylic acid methyl ester |
