Introduction:Basic information about CAS 138372-67-5|OXD-7; 2,2'-(1,3-Phenylene)-bis[5-(4-tert-butylphenyl)-1,3,4-oxadiazole], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | OXD-7; 2,2'-(1,3-Phenylene)-bis[5-(4-tert-butylphenyl)-1,3,4-oxadiazole] |
|---|
| CAS Number | 138372-67-5 | Molecular Weight | 478.585 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 625.7±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H30N4O2 | Melting Point | 241.42-243.29ºC |
|---|
| MSDS | / | Flash Point | 314.1±28.3 °C |
|---|
Names
| Name | 2,2'-(1,3-Phenylene)bis[5-(4-tert-butylphenyl)-1,3,4-oxadiazole] |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 625.7±65.0 °C at 760 mmHg |
|---|
| Melting Point | 241.42-243.29ºC |
|---|
| Molecular Formula | C30H30N4O2 |
|---|
| Molecular Weight | 478.585 |
|---|
| Flash Point | 314.1±28.3 °C |
|---|
| Exact Mass | 478.236877 |
|---|
| PSA | 77.84000 |
|---|
| LogP | 9.73 |
|---|
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | FQJQNLKWTRGIEB-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1ccc(-c2nnc(-c3cccc(-c4nnc(-c5ccc(C(C)(C)C)cc5)o4)c3)o2)cc1 |
|---|
Synonyms
| 1,3-Bis[2-(4-tert-butylphenyl)-1,3,4-oxadiazo-5-yl]benzene |
| 2,2'-(1,3-Phenylene)bis[5-(4-tert-butylphenyl)-1,3,4-oxadiazole] |
| 1,3,4-Oxadiazole, 2,2'-(1,3-phenylene)bis[5-[4-(1,1-dimethylethyl)phenyl]- |
| 2-(4-tert-butylphenyl)-5-[3-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-1,3,4-oxadiazole |
| 1,3-Bis[5-(4-tert-butylphenyl)-2-[1,3,4]oxadiazolyl]benzene |
| 1,3-Bis[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]benzene |
| 2,2'-(1,3-Phenylene)bis{5-[4-(2-methyl-2-propanyl)phenyl]-1,3,4-oxadiazole} |
| 1,3-Bis(5-(4-(tert-butyl)phenyl)-1,3,4-oxadiazol-2-yl)benzene |