Introduction：Basic information about CAS 367-80-6|Ethyl 4-fluoro-3-nitrobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-fluoro-3-nitrobenzoate |
|---|
| CAS Number | 367-80-6 | Molecular Weight | 213.163 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 312.3±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H8FNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 142.7±22.3 °C |
|---|
Names
| Name | Ethyl 4-fluoro-3-nitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 312.3±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H8FNO4 |
|---|
| Molecular Weight | 213.163 |
|---|
| Flash Point | 142.7±22.3 °C |
|---|
| Exact Mass | 213.043732 |
|---|
| PSA | 72.12000 |
|---|
| LogP | 2.12 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | YONVBKVUSUGBQR-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1ccc(F)c([N+](=O)[O-])c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Benzoic acid, 4-fluoro-3-nitro-, ethyl ester |
| Ethyl 4-fluoro-3-nitrobenzoate |
| ethyl 4-flouro-3-nitrobenzoate |
| MFCD03428515 |
| 4-Fluor-3-nitro-benzoesaeure-aethylester |
| 4-Fluoro-3-nitrobenzoic acid ethyl ester |
| Benzoic acid,4-fluoro-3-nitro-,ethyl ester |
| Ethyl-4-fluor-3-nitrobenzolcarboxylat |
| ethyl-4-fluoro-3-nitrobenzoate |
| Ethyl 3-nitro-4-Fluorobenzoate |
