Introduction:Basic information about CAS 61440-88-8|2,3-Dimesityl-2-cyclopropen-1-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3-Dimesityl-2-cyclopropen-1-one |
|---|
| CAS Number | 61440-88-8 | Molecular Weight | 290.399 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 479.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H22O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 210.6±23.7 °C |
|---|
Names
| Name | 2,3-bis(2,4,6-trimethylphenyl)cycloprop-2-en-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 479.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H22O |
|---|
| Molecular Weight | 290.399 |
|---|
| Flash Point | 210.6±23.7 °C |
|---|
| Exact Mass | 290.167053 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 6.54 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | LXCSCXXFUGZMQN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(-c2c(-c3c(C)cc(C)cc3C)c2=O)c(C)c1 |
|---|
Safety Information
Synonyms
| bis(2,4,6-trimethylphenyl)cyclopropenone |
| 2,3-dimesitylcyclopropenone |
| MFCD00051390 |
| 2,3-Bis(2,4,6-trimethylphenyl)cyclopropenone |
| 2-Cyclopropen-1-one,2,3-bis(2,4,6-trimethylphenyl) |
| 2,3-Dimesityl-2-cyclopropen-1-one |
| 1,2-dimesitylcyclopropenoe |
| 2-Cyclopropen-1-one, 2,3-bis(2,4,6-trimethylphenyl)- |
| dimesitylcyclopropenone |