Introduction：Basic information about CAS 3987-86-8|4-butoxy-2-nitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-butoxy-2-nitroaniline |
|---|
| CAS Number | 3987-86-8 | Molecular Weight | 210.23000 |
|---|
| Density | 1.187g/cm3 | Boiling Point | 366.9ºC at 760mmHg |
|---|
| Molecular Formula | C10H14N2O3 | Melting Point | 64-66ºC |
|---|
| MSDS | / | Flash Point | 175.7ºC |
|---|
Names
| Name | 4-butoxy-2-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.187g/cm3 |
|---|
| Boiling Point | 366.9ºC at 760mmHg |
|---|
| Melting Point | 64-66ºC |
|---|
| Molecular Formula | C10H14N2O3 |
|---|
| Molecular Weight | 210.23000 |
|---|
| Flash Point | 175.7ºC |
|---|
| Exact Mass | 210.10000 |
|---|
| PSA | 81.07000 |
|---|
| LogP | 3.46030 |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | BBELMWNCSCNWAO-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOc1ccc(N)c([N+](=O)[O-])c1 |
|---|
Safety Information
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | 36/37 |
|---|
| HS Code | 2922299090 |
|---|
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Benzenamine,4-butoxy-2-nitro |
| 2-Nitro-4-butyloxy-anilin |
| 4-butoxy-2-nitrophenylamine |
| 4-butoxy-2-nitro-aniline |
| 2-Amino-5-butoxynitrobenzene |
| MFCD01320679 |
| 1-amino-4-n-butoxy-2-nitrobenzene |
| 4-n-butoxy-2-nitroaniline |
| 4-Butoxy-2-nitro-anilin |
