Introduction：Basic information about CAS 397845-49-7|4,6-BIS(4-BROMOPHENYL)-2(1H)-PYRIDONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,6-BIS(4-BROMOPHENYL)-2(1H)-PYRIDONE |
|---|
| CAS Number | 397845-49-7 | Molecular Weight | 405.08300 |
|---|
| Density | 1.671g/cm3 | Boiling Point | 574.5ºC at 760mmHg |
|---|
| Molecular Formula | C17H11Br2NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 301.3ºC |
|---|
Names
| Name | 4,6-bis(4-bromophenyl)-1H-pyridin-2-one |
|---|
Chemical & Physical Properties
| Density | 1.671g/cm3 |
|---|
| Boiling Point | 574.5ºC at 760mmHg |
|---|
| Molecular Formula | C17H11Br2NO |
|---|
| Molecular Weight | 405.08300 |
|---|
| Flash Point | 301.3ºC |
|---|
| Exact Mass | 402.92100 |
|---|
| PSA | 32.86000 |
|---|
| LogP | 5.23390 |
|---|
| Index of Refraction | 1.665 |
|---|
| InChIKey | RBAOEYJFGUCXNS-UHFFFAOYSA-N |
|---|
| SMILES | O=c1cc(-c2ccc(Br)cc2)cc(-c2ccc(Br)cc2)[nH]1 |
|---|
