CAS 1656-44-6|2,4-Dinitrobenzenesulfonyl chloride
Introduction：Basic information about CAS 1656-44-6|2,4-Dinitrobenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-Dinitrobenzenesulfonyl chloride | ||
|---|---|---|---|
| CAS Number | 1656-44-6 | Molecular Weight | 266.616 |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 418.1±35.0 °C at 760 mmHg |
| Molecular Formula | C6H3ClN2O6S | Melting Point | 101-103 °C(lit.) |
| MSDS | ChineseUSA | Flash Point | 206.6±25.9 °C |
| Symbol | GHS05, GHS08 | Signal Word | Danger |
Names
| Name | 2,4-dinitrobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 418.1±35.0 °C at 760 mmHg |
| Melting Point | 101-103 °C(lit.) |
| Molecular Formula | C6H3ClN2O6S |
| Molecular Weight | 266.616 |
| Flash Point | 206.6±25.9 °C |
| Exact Mass | 265.940033 |
| PSA | 134.16000 |
| LogP | 2.14 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | SSFSNKZUKDBPIT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Cl)c([N+](=O)[O-])c1 |
Safety Information
| Symbol | GHS05, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H340-H350-H373 |
| Precautionary Statements | P201-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R34 |
| Safety Phrases | S53-S26-S36/37/39-S45-S62 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
Customs
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
Articles2
More Articles| Synthesis of _-Glycosyl Amides from N-Glycosyl Dinitrobenzenesulfonamides. J. Carbohydr. Chem. 31(4-6) , 353-370, (2012) The N-glycosyl-2,4-dinitrobenzenesulfonamides were accessed via benzoyl-protected _-glycosyl azides. The azides were reduced with Adams' catalyst to the corresponding amines. The glycosylamines were s... | |
| Peptide nucleic acid probes with charged photocleavable mass markers: Towards PNA-based MALDI-TOF MS genetic analysis. Artif. DNA PNA XNA 1(1) , 27-35, (2010) Halogen-labelled peptide organic acid (HPOA) monomers have been synthesised and incorporated into sequence-specific peptide nucleic acid (PNA) probes. Three different types of probe have been prepared... |
Synonyms
| Benzenesulfonyl chloride, 2,4-dinitro- |
| 4-NO2-2-Nos-Cl |
| 2,4-Dinitrobenzenesulfonyl chloride |
| Benzenesulfonyl chloride,2,4-dinitro |
| 2,4-dinitrobenzylsulfonyl chloride |
| DNBS-chloride |
| 2,4-dinitrophenylsulfonyl chloride |
| 2,4-dinitrobenzene-sulfonyl chloride |
| 2,4-Dinitrobenzene-1-sulfonyl chloride |
| EINECS 216-749-3 |
| MFCD00007431 |
| 2,4-Dinitrobenzenesulphonyl chloride |
