Introduction：Basic information about CAS 61477-97-2|Dazolicine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dazolicine |
|---|
| CAS Number | 61477-97-2 | Molecular Weight | 337.91100 |
|---|
| Density | 1.25g/cm3 | Boiling Point | 500.4ºC at 760 mmHg |
|---|
| Molecular Formula | C17H24ClN3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 256.5ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.25g/cm3 |
|---|
| Boiling Point | 500.4ºC at 760 mmHg |
|---|
| Molecular Formula | C17H24ClN3S |
|---|
| Molecular Weight | 337.91100 |
|---|
| Flash Point | 256.5ºC |
|---|
| Exact Mass | 337.13800 |
|---|
| PSA | 44.14000 |
|---|
| LogP | 3.59330 |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | RZAGBWYFAWQKAE-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)N1CCN=C1CN1CCCCSc2ccc(Cl)cc21 |
|---|
