Introduction：Basic information about CAS 365541-74-8|Aliskiren inter-10, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Aliskiren inter-10 |
|---|
| CAS Number | 365541-74-8 | Molecular Weight | 381.46500 |
|---|
| Density | 1.165 | Boiling Point | 535.9ºC at 760 mmHg |
|---|
| Molecular Formula | C23H27NO4 | Melting Point | 74-75ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Aliskiren inter-10 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.165 |
|---|
| Boiling Point | 535.9ºC at 760 mmHg |
|---|
| Melting Point | 74-75ºC |
|---|
| Molecular Formula | C23H27NO4 |
|---|
| Molecular Weight | 381.46500 |
|---|
| Exact Mass | 381.19400 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 4.00340 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | OSMMPQFRVPFIQZ-RTWAWAEBSA-N |
|---|
| SMILES | CC(C)C(COCc1ccccc1)C(=O)N1C(=O)OCC1Cc1ccccc1 |
|---|
Synonyms
| (R)-4-benzyl-3-((S)-2-(benzyloxymethyl)-3-methylbutanoyl)oxazolidin-2-one |
| (4R)-3-{(2S)-3-methyl-1-oxo-2-[(phenylmethoxy)methyl]butyl}-4-(phenylmethyl)oxazolidin-2-one |
| (4R)-3-[(2S)-3-Methyl-1-oxo-2-[(phenylmethoxy)methyl]butyl]-4-(phenylmethyl)-2-oxazolidinone |
| (3(2S),4R)-4-benzyl-3-(2-[(benzyloxy)methyl]-3-methyl-1-oxobutyl)-2-oxazolidinone |
