Introduction：Basic information about CAS 13912-77-1|Amplicaine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Amplicaine |
|---|
| CAS Number | 13912-77-1 | Molecular Weight | 234.33700 |
|---|
| Density | 1.022g/cm3 | Boiling Point | 383.2ºC at 760mmHg |
|---|
| Molecular Formula | C14H22N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 185.6ºC |
|---|
Names
| Name | 3-(diethylamino)-N-phenylbutanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.022g/cm3 |
|---|
| Boiling Point | 383.2ºC at 760mmHg |
|---|
| Molecular Formula | C14H22N2O |
|---|
| Molecular Weight | 234.33700 |
|---|
| Flash Point | 185.6ºC |
|---|
| Exact Mass | 234.17300 |
|---|
| PSA | 32.34000 |
|---|
| LogP | 2.81850 |
|---|
| Vapour Pressure | 4.46E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.54 |
|---|
| InChIKey | HKOURKRGAFKVFP-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)C(C)CC(=O)Nc1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3-Diaethylamino-buttersaeure-anilid |
| Octacaina |
| 3-diethylamino-butyric acid anilide |
| Octacaine |
| Amplicaine |
| 3-Diethylaminobutyranilid |
| Octacainum |
| Octacaine [INN] |
| 3-(Diethylamino)butyranilide |
