Introduction：Basic information about CAS 16252-88-3|2,1,3-Benzothiadiazole,5-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,1,3-Benzothiadiazole,5-nitro- |
|---|
| CAS Number | 16252-88-3 | Molecular Weight | 181.17200 |
|---|
| Density | 1.627g/cm3 | Boiling Point | 314.3ºC at 760mmHg |
|---|
| Molecular Formula | C6H3N3O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 143.9ºC |
|---|
Names
| Name | 5-nitro-2,1,3-benzothiadiazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.627g/cm3 |
|---|
| Boiling Point | 314.3ºC at 760mmHg |
|---|
| Molecular Formula | C6H3N3O2S |
|---|
| Molecular Weight | 181.17200 |
|---|
| Flash Point | 143.9ºC |
|---|
| Exact Mass | 180.99500 |
|---|
| PSA | 99.84000 |
|---|
| LogP | 2.12270 |
|---|
| Vapour Pressure | 0.000867mmHg at 25°C |
|---|
| Index of Refraction | 1.746 |
|---|
| InChIKey | BXZPSERJJMAPSV-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc2nsnc2c1 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| 5-nitrobenzo[1,2,5]thiadiazole |
| 5-nitrobenzo-2,1,3-thiadiazole |
| 5-(Hydroxy(oxido)amino)-2,1,3-benzothiadiazole |
| 5-Nitro-<2.1.3>benzothiadiazol |
| 5-nitrobenzothiadiazole |
