Introduction：Basic information about CAS 13685-26-2|chloro-bis(4-chlorophenyl)phosphane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | chloro-bis(4-chlorophenyl)phosphane |
|---|
| CAS Number | 13685-26-2 | Molecular Weight | 289.52500 |
|---|
| Density | / | Boiling Point | 184-186ºC/2.5mm |
|---|
| Molecular Formula | C12H8Cl3P | Melting Point | 52-53ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | chloro-bis(4-chlorophenyl)phosphane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 184-186ºC/2.5mm |
|---|
| Melting Point | 52-53ºC |
|---|
| Molecular Formula | C12H8Cl3P |
|---|
| Molecular Weight | 289.52500 |
|---|
| Exact Mass | 287.94300 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 4.57990 |
|---|
| Vapour Pressure | 2.36E-05mmHg at 25°C |
|---|
| InChIKey | UISLTICQIVPVGS-UHFFFAOYSA-N |
|---|
| SMILES | Clc1ccc(P(Cl)c2ccc(Cl)cc2)cc1 |
|---|
Safety Information
| RIDADR | UN3261 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2903999090 |
|---|
Customs
| HS Code | 2903999090 |
|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| bis(4-chlorophenyl)chlorophosphine |
| Bis(p-chlorophenyl)phosphine chloride |
| Phosphinouschloride,bis(p-chlorophenyl)-(7CI,8CI) |
| Chlorobis(4-chlorophenyl)phosphine |
| MFCD09909564 |
| Di(p-chlorophenyl)phosphine chloride |
| Chlor-bis-(4-chlor-phenyl)-phosphin |
