Introduction:Basic information about CAS 160842-62-6|3-(tert-butyl)-1-methyl-1H-pyrazole-5-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(tert-butyl)-1-methyl-1H-pyrazole-5-carbonyl chloride |
|---|
| CAS Number | 160842-62-6 | Molecular Weight | 200.66500 |
|---|
| Density | 1.16g/cm3 | Boiling Point | 117ºC |
|---|
| Molecular Formula | C9H13ClN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 121.1ºC |
|---|
Names
| Name | 5-tert-butyl-2-methylpyrazole-3-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.16g/cm3 |
|---|
| Boiling Point | 117ºC |
|---|
| Molecular Formula | C9H13ClN2O |
|---|
| Molecular Weight | 200.66500 |
|---|
| Flash Point | 121.1ºC |
|---|
| Exact Mass | 200.07200 |
|---|
| PSA | 34.89000 |
|---|
| LogP | 2.09660 |
|---|
| Vapour Pressure | 0.00474mmHg at 25°C |
|---|
| Index of Refraction | 1.533 |
|---|
| InChIKey | SJGURXGUNLVMAQ-UHFFFAOYSA-N |
|---|
| SMILES | Cn1nc(C(C)(C)C)cc1C(=O)Cl |
|---|
Safety Information
| Hazard Codes | C |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | UN 3265 |
|---|
| HS Code | 2933199090 |
|---|
Customs
| HS Code | 2933199090 |
|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-t-butyl-1-methyl-5-pyrazolecarboxylic acid chloride |
| 5-tert-Butyl-2-methyl-2H-pyrazole-3-carbonyl chloride |
| 3-(tert-Butyl)-1-methylpyrazole-5-carbonyl chloride |
| 3-tert-Butyl-1-methyl-1H-pyrazole-5-carbonyl chloride |
| MFCD00084916 |
| 3-t-butyl-1-methyl-1H-pyrazole-5-carbonyl chloride |