Introduction:Basic information about CAS 316810-81-8|4-Chloro-7-nitro-1H-indazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-7-nitro-1H-indazole |
|---|
| CAS Number | 316810-81-8 | Molecular Weight | 197.579 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 410.1±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H4ClN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 201.9±23.2 °C |
|---|
Names
| Name | 4-chloro-7-nitro-1H-indazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 410.1±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H4ClN3O2 |
|---|
| Molecular Weight | 197.579 |
|---|
| Flash Point | 201.9±23.2 °C |
|---|
| Exact Mass | 196.999207 |
|---|
| PSA | 74.50000 |
|---|
| LogP | 2.10 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.742 |
|---|
| InChIKey | MGCGMFQHBXYECU-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(Cl)c2cn[nH]c12 |
|---|
Synonyms
| 4-chloro-7-nitro-1(2)H-indazole |
| 1H-Indazole,4-chloro-7-nitro |
| 1H-Indazole, 4-chloro-7-nitro- |
| 4-Chloro-7-nitro-1H-indazole |
| 4-Chlor-7-nitro-1(2)H-indazol |
| 4-Chloro-7-nitro indazole |