Introduction：Basic information about CAS 13058-16-7|benzyloxycarbonyltryptophan, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | benzyloxycarbonyltryptophan |
|---|
| CAS Number | 13058-16-7 | Molecular Weight | 338.357 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 619.1±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H18N2O4 | Melting Point | 170ºC |
|---|
| MSDS | / | Flash Point | 328.2±31.5 °C |
|---|
Names
| Name | N-Cbz-DL-Tryptophan |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 619.1±55.0 °C at 760 mmHg |
|---|
| Melting Point | 170ºC |
|---|
| Molecular Formula | C19H18N2O4 |
|---|
| Molecular Weight | 338.357 |
|---|
| Flash Point | 328.2±31.5 °C |
|---|
| Exact Mass | 338.126648 |
|---|
| PSA | 94.91000 |
|---|
| LogP | 3.50 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.662 |
|---|
| InChIKey | AHYFYYVVAXRMKB-UHFFFAOYSA-N |
|---|
| SMILES | O=C(NC(Cc1c[nH]c2ccccc12)C(=O)O)OCc1ccccc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| WGK Germany | 3 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| N-Carbobenzoxy-DL-tryptophan |
| Z-DL-Trp-OH |
| EINECS 235-949-1 |
| CARBOBENZYLOXY-DL-TRYPTOPHAN |
| N-[(Benzyloxy)carbonyl]tryptophan |
| N-Cbz-DL-tryptophan |
| MFCD00069707 |
| benzyloxycarbonyltryptophan |
| 2-{[(Benzyloxy)carbonyl]amino}-3-(1H-indol-3-yl)propanoic acid |
| Tryptophan, N-[(phenylmethoxy)carbonyl]- |
