Introduction：Basic information about CAS 2538-52-5|1H-Pyrazole,4,5-dihydro-1,3-diphenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Pyrazole,4,5-dihydro-1,3-diphenyl- |
|---|
| CAS Number | 2538-52-5 | Molecular Weight | 222.28500 |
|---|
| Density | 1.08g/cm3 | Boiling Point | 351.9ºC at 760mmHg |
|---|
| Molecular Formula | C15H14N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 166.6ºC |
|---|
Names
| Name | 2,5-diphenyl-3,4-dihydropyrazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.08g/cm3 |
|---|
| Boiling Point | 351.9ºC at 760mmHg |
|---|
| Molecular Formula | C15H14N2 |
|---|
| Molecular Weight | 222.28500 |
|---|
| Flash Point | 166.6ºC |
|---|
| Exact Mass | 222.11600 |
|---|
| PSA | 15.60000 |
|---|
| LogP | 2.80160 |
|---|
| Vapour Pressure | 3.98E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.613 |
|---|
| InChIKey | ZWCZPVMIHLKVLD-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc(C2=NN(c3ccccc3)CC2)cc1 |
|---|
Synonyms
| 1,3-diphenyl-4,5-dihydropyrazole |
| 1,3-phenyl-2-pyrazoline |
| 1,3-Diphenyl-4,5-dihydro-1H-pyrazol |
| 2-Pyrazoline,3-diphenyl |
| 1,3-Diphenylpyrazoline |
| 1,3-Diphenyl-2-pyrazoline |
| 1,3-Diphenyl-4,5-dihydro-1H-pyrazole |
