Introduction:Basic information about CAS 3147-77-1|2-(2-Hydroxy-4-octyloxyphenyl)-[2H]-benzotriazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2-Hydroxy-4-octyloxyphenyl)-[2H]-benzotriazole |
|---|
| CAS Number | 3147-77-1 | Molecular Weight | 339.43100 |
|---|
| Density | 1.162g/cm3 | Boiling Point | 512.394ºC at 760 mmHg |
|---|
| Molecular Formula | C20H25N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 263.687ºC |
|---|
Names
| Name | 2-(benzotriazol-2-yl)-5-octoxyphenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.162g/cm3 |
|---|
| Boiling Point | 512.394ºC at 760 mmHg |
|---|
| Molecular Formula | C20H25N3O2 |
|---|
| Molecular Weight | 339.43100 |
|---|
| Flash Point | 263.687ºC |
|---|
| Exact Mass | 339.19500 |
|---|
| PSA | 60.17000 |
|---|
| LogP | 4.86540 |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | ITLDHFORLZTRJI-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCOc1ccc(-n2nc3ccccc3n2)c(O)c1 |
|---|
Synonyms
| 2-(2-hydroxy-4-octyloxyphenyl)-[2h]-benzotriazole |
| Viosorb 510 |
| 2-(2H-Benzotriazol-2-yl)-5-(octyloxy)phenol |
| Sumisorb 310 |
| Seesorb 707 |
| 2-(2'-Hydroxy-4'-octyloxyphenyl)benzotriazole |
| Sumisorb 510 |
| Phenol,2-(2H-benzotriazol-2-yl)-5-(octyloxy) |