Introduction：Basic information about CAS 139551-74-9|Fmoc-Neopentylglycine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-Neopentylglycine |
|---|
| CAS Number | 139551-74-9 | Molecular Weight | 367.438 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 537.3±29.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H25NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 278.7±24.3 °C |
|---|
Names
| Name | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4,4-dimethylpentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 537.3±29.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H25NO4 |
|---|
| Molecular Weight | 367.438 |
|---|
| Flash Point | 278.7±24.3 °C |
|---|
| Exact Mass | 367.178345 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 5.45 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | RPLVCXKSSXJFDS-IBGZPJMESA-N |
|---|
| SMILES | CC(C)(C)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
|---|
Safety Information
Synonyms
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-methyl-L-leucine |
| N-(2,2-Dimethylpropyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]glycine |
| L-Leucine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-4-methyl- |
| Fmoc-β-t-butyl-L-alanine |
| Glycine, N-(2,2-dimethylpropyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| Fmoc-Neopentylglycine |
