Introduction：Basic information about CAS 160347-94-4|Fmoc-D-Arg(NO2)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-D-Arg(NO2)-OH |
|---|
| CAS Number | 160347-94-4 | Molecular Weight | 441.437 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C21H23N5O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2R)-5-[[amino(nitramido)methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Molecular Formula | C21H23N5O6 |
|---|
| Molecular Weight | 441.437 |
|---|
| Exact Mass | 441.164825 |
|---|
| PSA | 169.36000 |
|---|
| LogP | 3.44 |
|---|
| Index of Refraction | 1.674 |
|---|
| InChIKey | RXMHIKWOZKQXCJ-GOSISDBHSA-N |
|---|
| SMILES | NC(=NCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)N[N+](=O)[O-] |
|---|
| Storage condition | Store at?0-5°C |
|---|
Safety Information
Synonyms
| Nalpha-Fmoc-Nomega-nitro-L-arginine |
| fmoc-nw-nitro-d-arginine |
| Fmoc-D-Arg(NO2)-OH |
| D-Ornithine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-[imino(nitroamino)methyl]- |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-(N-nitrocarbamimidoyl)-D-ornithine |
| (2R)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-5-(1-nitrocarbamimidamido)pentanoic acid |
