Introduction：Basic information about CAS 1668-53-7|4-[2,6-bis(2,4-dimethylphenyl)-1H-1,3,5-triazin-4-ylidene]-3-hydroxycyclohexa-2,5-dien, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[2,6-bis(2,4-dimethylphenyl)-1H-1,3,5-triazin-4-ylidene]-3-hydroxycyclohexa-2,5-dien-1-one |
|---|
| CAS Number | 1668-53-7 | Molecular Weight | 397.469 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 659.1±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H23N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 352.4±34.3 °C |
|---|
Names
| Name | 4-[2,6-bis(2,4-dimethylphenyl)-1H-1,3,5-triazin-4-ylidene]-3-hydroxycyclohexa-2,5-dien-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 659.1±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H23N3O2 |
|---|
| Molecular Weight | 397.469 |
|---|
| Flash Point | 352.4±34.3 °C |
|---|
| Exact Mass | 397.179016 |
|---|
| PSA | 79.13000 |
|---|
| LogP | 7.30 |
|---|
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | FROCQMFXPIROOK-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(O)cc3O)n2)c(C)c1 |
|---|
Safety Information
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 4-(4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)benzene-1,3-diol |
| DBDT |
| 4-[4,6-Bis(2,4-dimethylphenyl)-5H-s-triazin-2-ylidene]-3-hydroxy-cyclohexa-2,5-dien-1-one |
| 2,6-bis-(2,4-dimethylphenyl)-4-(2,4-dihydroxyphenyl)-s-triazine |
| 4-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]benzene-1,3-diol |
| 1,3-Benzenediol, 4-(4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)- |
| 2-(2,4-dihydroxyphenyl)-4,6-bis(2,4-dimethylphenyl)-1,3,5-triazine |
| 1,3-Benzenediol, 4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]- |
| 4-[4,6-bis-(2,4-dimethyl-phenyl)-[1,3,5]triazin-2-yl]-benzene-1,3-diol |
| 4-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-1,3-benzenediol |
| 2,4-bis(2`,4`-dimethylphenyl)-6-(2``,4``-dihydroxyphenyl)-1,3,5-triazine |
| 4,6-bis-(2,4-dimethylphenyl)-2-(2,4-dihydroxyphenyl)-s-triazine |
