Introduction：Basic information about CAS 161485-60-5|N,N,N',N'-Tetrakis(4-methylphenyl)benzidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N,N',N'-Tetrakis(4-methylphenyl)benzidine |
|---|
| CAS Number | 161485-60-5 | Molecular Weight | 544.727 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 701.7±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C40H36N2 | Melting Point | 210ºC |
|---|
| MSDS | / | Flash Point | 310.7±20.7 °C |
|---|
Names
| Name | N,N,N',N'-Tetrakis(4-methylphenyl)benzidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 701.7±60.0 °C at 760 mmHg |
|---|
| Melting Point | 210ºC |
|---|
| Molecular Formula | C40H36N2 |
|---|
| Molecular Weight | 544.727 |
|---|
| Flash Point | 310.7±20.7 °C |
|---|
| Exact Mass | 544.287842 |
|---|
| PSA | 6.48000 |
|---|
| LogP | 12.86 |
|---|
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.659 |
|---|
| InChIKey | AAVPITVHLAHPPZ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2cccc(-c3cccc(N(c4ccc(C)cc4)c4ccc(C)cc4)c3)c2)cc1 |
|---|
Synonyms
| N,N,N',N'-Tetrakis(4-methylphenyl)-4,4'-biphenyldiamine |
| N,N,N',N'-Tetrakis(4-methylphenyl)benzidine |
| [1,1'-Biphenyl]-3,3'-diamine, N,N,N,N-tetrakis(4-methylphenyl)- |
| N,N,N',N'-Tetrakis(4-methylphenyl)-benzidine |
| N,N,N',N'-Tetrakis(4-methylphenyl)-3,3'-biphenyldiamine |
| N,N,N',N'-Tetrakis(4-methylphenyl)biphenyl-4,4'-diamine |
| [1,1'-Biphenyl]-4,4'-diamine, N,N,N,N-tetrakis(4-methylphenyl)- |
