Introduction：Basic information about CAS 16383-89-4|2-Ethoxy-4-nitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Ethoxy-4-nitroaniline |
|---|
| CAS Number | 16383-89-4 | Molecular Weight | 182.177 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 369.4±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 177.2±22.3 °C |
|---|
Names
| Name | 2-ethoxy-4-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 369.4±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O3 |
|---|
| Molecular Weight | 182.177 |
|---|
| Flash Point | 177.2±22.3 °C |
|---|
| Exact Mass | 182.069138 |
|---|
| PSA | 81.07000 |
|---|
| LogP | 2.38 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | OWRHDQKCCXTFFE-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1cc([N+](=O)[O-])ccc1N |
|---|
Safety Information
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-Nitro-o-phenetidin |
| 5-Nitro-2-amino-phenol-aethylaether |
| Benzenamine,2-ethoxy-4-nitro |
| Benzenamine, 2-ethoxy-4-nitro- |
| 2-ethoxy-4-nitro-aniline |
| 5-Nitro-2-amino-1-ethoxybenzene |
| 5-nitro-2-amino-phenetole |
| 2-Aethoxy-4-nitro-anilin |
| EINECS 240-431-3 |
| 4-Nitro-o-phenetidine |
| 2-Ethyoxy-4-nitroaniline |
| 2-Ethoxy-4-nitroaniline |
