Introduction：Basic information about CAS 25691-37-6|Boc-L-2,4-diaminobutyric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-L-2,4-diaminobutyric acid |
|---|
| CAS Number | 25691-37-6 | Molecular Weight | 218.250 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 385.1±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H18N2O4 | Melting Point | 202 °C(dec.) |
|---|
| MSDS | ChineseUSA | Flash Point | 186.7±27.9 °C |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 385.1±42.0 °C at 760 mmHg |
|---|
| Melting Point | 202 °C(dec.) |
|---|
| Molecular Formula | C9H18N2O4 |
|---|
| Molecular Weight | 218.250 |
|---|
| Flash Point | 186.7±27.9 °C |
|---|
| Exact Mass | 218.126663 |
|---|
| PSA | 101.65000 |
|---|
| LogP | 0.50 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.501 |
|---|
| InChIKey | MDCPCLPRWLKUIQ-LURJTMIESA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CCN)C(=O)O |
|---|
| Storage condition | Store at RT. |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H315-H318 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 38-41 |
|---|
| Safety Phrases | 26-39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| (S)-Nα-Boc-2,4-diaminobutyric Acid |
| 2,4-Diamino-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid |
| BOC-DAB |
| MFCD00236841 |
| 2,4-Diamino-5-tert-butoxy-5-oxopentanoic acid (non-preferred name) |
| Boc-Daba-OH |
| tert-butoxycarbonyl-diaminobutyric acid |
| Boc-Dab-OH |
| AmbotzBAA1087 |
| (2S)-4-Ammonio-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoate |
| 1-Propanaminium, 3-carboxy-3-[[(1,1-dimethylethoxy)carbonyl]amino]-, inner salt, (3S)- |
| (S)-4-Amino-2-(Boc-amino)butyric Acid |
| BOC-L-DAB-OH |
| Glutamic acid, 4-amino-, 1-(1,1-dimethylethyl) ester |
| (S)-4-Amino-2-(tert-butoxycarbonylamino)butanoic acid |
| Boc-L-2,4-Diaminobutyric Acid |
| (S)-4-Amino-2-(tert-butoxycarbonylamino)butyric acid |
