Introduction：Basic information about CAS 25830-77-7|phthaloyl-l-glutamic anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | phthaloyl-l-glutamic anhydride |
|---|
| CAS Number | 25830-77-7 | Molecular Weight | 259.214 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 484.8±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H9NO5 | Melting Point | 205ºC |
|---|
| MSDS | / | Flash Point | 247.0±26.8 °C |
|---|
Names
| Name | 2-[(3S)-2,6-dioxooxan-3-yl]isoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 484.8±38.0 °C at 760 mmHg |
|---|
| Melting Point | 205ºC |
|---|
| Molecular Formula | C13H9NO5 |
|---|
| Molecular Weight | 259.214 |
|---|
| Flash Point | 247.0±26.8 °C |
|---|
| Exact Mass | 259.048065 |
|---|
| PSA | 80.75000 |
|---|
| LogP | 0.29 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.647 |
|---|
| InChIKey | ICDLEMPZXFCQEB-VIFPVBQESA-N |
|---|
| SMILES | O=C1CCC(N2C(=O)c3ccccc3C2=O)C(=O)O1 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| N-Phthalyl-L-glutamic anhydride |
| 1H-Isoindole-1,3(2H)-dione, 2-[(3S)-tetrahydro-2,6-dioxo-2H-pyran-3-yl]- |
| N-Phthaloyl-L-glutamic acid anhydride |
| P0620 |
| L-N-Phthalylglutamic anhydride |
| phthaloyl-L-glutamic acid anhydride |
| 2-[(3S)-2,6-Dioxotetrahydro-2H-pyran-3-yl]-1H-isoindole-1,3(2H)-dione |
| N-phthaloyl glutamic anhydride |
| N-Phthaloyl-L-glutamoyl anhydride |
| N,N-phthalyl-L-glutamic 1,5-anhydride |
| N,N-phthaloyl-L-glutamic acid-anhydride |
| phthaloyl-L-glutamyl anhydride |
| N-Phthaloyl-l-glutamic anhydride |
