Introduction：Basic information about CAS 258346-69-9|1-(4-Trifluoromethylphenyl)butane-1,3-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-Trifluoromethylphenyl)butane-1,3-dione |
|---|
| CAS Number | 258346-69-9 | Molecular Weight | 230.183 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 287.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H9F3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 101.3±24.1 °C |
|---|
Names
| Name | 1-[4-(trifluoromethyl)phenyl]butane-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 287.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H9F3O2 |
|---|
| Molecular Weight | 230.183 |
|---|
| Flash Point | 101.3±24.1 °C |
|---|
| Exact Mass | 230.055466 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 3.49 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.460 |
|---|
| InChIKey | DLIOGFQTFUVFFB-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)CC(=O)c1ccc(C(F)(F)F)cc1 |
|---|
Synonyms
| 1-p-trifluoromethylphenylbutane-1,3-dione |
| 1,3-Butanedione,1-[4-(trifluoromethyl)phenyl] |
| 1,3-Butanedione, 1-[4-(trifluoromethyl)phenyl]- |
| 1-(4-Trifluoromethylphenyl)butane-1,3-dione |
| 1-[4-(Trifluoromethyl)phenyl]-1,3-butanedione |
