Introduction：Basic information about CAS 25774-02-1|phenylmalonic acid monobenzyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | phenylmalonic acid monobenzyl ester |
|---|
| CAS Number | 25774-02-1 | Molecular Weight | 270.28000 |
|---|
| Density | 1.258g/cm3 | Boiling Point | 432.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H14O4 | Melting Point | 64-66°C |
|---|
| MSDS | / | Flash Point | 160.2ºC |
|---|
Names
| Name | phenylmalonic acid monobenzyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.258g/cm3 |
|---|
| Boiling Point | 432.1ºC at 760mmHg |
|---|
| Melting Point | 64-66°C |
|---|
| Molecular Formula | C16H14O4 |
|---|
| Molecular Weight | 270.28000 |
|---|
| Flash Point | 160.2ºC |
|---|
| Exact Mass | 270.08900 |
|---|
| PSA | 63.60000 |
|---|
| LogP | 2.59820 |
|---|
| Vapour Pressure | 3.12E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | QSBAHMROFICXDC-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(C(=O)OCc1ccccc1)c1ccccc1 |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| phenyl malonic acid monobenzyl ester |
| benzyl hydrogen phenylmalonate |
| MONOBENZYL PHENYLMALONATE |
| 2-Phenylpropanedioic acid hydrogen 1-phenylmethyl ester |
| monobenzyl 2-phenylmalonate |
| EINECS 247-257-7 |
| 2-phenylpropanedioic acid monobenzyl ester |
| Phenylmalonic Acid Monobenzyl Ester |
| MFCD00051723 |
| benzyl hydrogen 2-phenylmalonate |
