Introduction：Basic information about CAS 257876-10-1|6-Phenylnicotinoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Phenylnicotinoyl chloride |
|---|
| CAS Number | 257876-10-1 | Molecular Weight | 217.651 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 349.5±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H8ClNO | Melting Point | 107ºC |
|---|
| MSDS | / | Flash Point | 165.2±24.6 °C |
|---|
Names
| Name | 6-phenylpyridine-3-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 349.5±30.0 °C at 760 mmHg |
|---|
| Melting Point | 107ºC |
|---|
| Molecular Formula | C12H8ClNO |
|---|
| Molecular Weight | 217.651 |
|---|
| Flash Point | 165.2±24.6 °C |
|---|
| Exact Mass | 217.029449 |
|---|
| PSA | 29.96000 |
|---|
| LogP | 2.93 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | ISXWEXCQEVPRQZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1ccc(-c2ccccc2)nc1 |
|---|
Safety Information
| Hazard Codes | C:Corrosive |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
Synonyms
| 6-phenyl-3-pyridinecarbonyl chloride |
| 2-Phenyl-pyridin-5-carbonylchlorid |
| 2-phenyl-5-pyridinecarbonyl chloride |
| 6-Phenylnicotinoyl chloride |
| 3-Pyridinecarbonyl chloride, 6-phenyl- |
| 3-Pyridinecarbonylchloride,6-phenyl |
