Introduction：Basic information about CAS 39267-53-3|Methyl 4-acetamido-3-hydroxybenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4-acetamido-3-hydroxybenzoate |
|---|
| CAS Number | 39267-53-3 | Molecular Weight | 209.19900 |
|---|
| Density | 1.317g/cm3 | Boiling Point | 441.2ºC at 760 mmHg |
|---|
| Molecular Formula | C10H11NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.6ºC |
|---|
Names
| Name | Methyl 4-acetamido-3-hydroxybenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.317g/cm3 |
|---|
| Boiling Point | 441.2ºC at 760 mmHg |
|---|
| Molecular Formula | C10H11NO4 |
|---|
| Molecular Weight | 209.19900 |
|---|
| Flash Point | 220.6ºC |
|---|
| Exact Mass | 209.06900 |
|---|
| PSA | 79.12000 |
|---|
| LogP | 1.78670 |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | QPZCIKBBXHQUMD-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(NC(C)=O)c(O)c1 |
|---|
Synonyms
| halogenosulfanilamide deriv. 4b |
| 4-acetylamino-3-fluoro-benzenesulfonic acid amide |
| methyl 4-acetamide-3-hydroxybenzoate |
| 4-Acetylamino-3-fluor-benzolsulfonsaeure-amid |
| 4-Acetylamino-3-hydroxy-benzoesaeure-methylester |
| 4-acetylamino-3-hydroxy-benzoic acid methyl ester |
| 4-Acetamino-3-oxy-benzoesaeuremethylester |
