Introduction:Basic information about CAS 136630-36-9|4,4'-Dibromo-2,2'-biphenyldiamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Dibromo-2,2'-biphenyldiamine |
|---|
| CAS Number | 136630-36-9 | Molecular Weight | 342.029 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | 436.5±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H10Br2N2 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 217.8±27.3 °C |
|---|
| Symbol | GHS05, GHS07, GHS09 | Signal Word | Danger |
|---|
Names
| Name | 2-(2-amino-4-bromophenyl)-5-bromoaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Boiling Point | 436.5±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H10Br2N2 |
|---|
| Molecular Weight | 342.029 |
|---|
| Flash Point | 217.8±27.3 °C |
|---|
| Exact Mass | 339.921051 |
|---|
| PSA | 52.04000 |
|---|
| LogP | 3.98 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.708 |
|---|
| InChIKey | KZDMFBDNQPKWNM-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(Br)ccc1-c1ccc(Br)cc1N |
|---|
Safety Information
| Symbol | GHS05, GHS07, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H315-H318-H335-H400 |
|---|
| Precautionary Statements | P261-P273-P280-P305 + P351 + P338 |
|---|
| RIDADR | UN 3077 9 / PGIII |
|---|
| HS Code | 2921590090 |
|---|
Customs
| HS Code | 2921590090 |
|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2,2'-diamino-4,4'-dibromobiphenyl |
| 4,4'-Dibromo-[1,1'-biphenyl]-2,2'-diamine |
| [1,1'-Biphenyl]-2,2'-diamine,4,4'-dibromo |
| 4,4'-dibromobiphenyl-2,2'-diamine |
| 4,4'-dibromo-2,2'-diaminobiphenyl |
| 4,4'-dibromo-biphenyl-2,2'-diyldiamine |
| 4,4'-Dibrom-biphenyl-2,2'-diyldiamin |
| [1,1'-Biphenyl]-2,2'-diamine, 4,4'-dibromo- |
| 4,4'-Dibromo-2,2'-biphenyldiamine |
| 4.4'-Dibrom-2.2'-diamino-diphenyl |