Introduction：Basic information about CAS 16428-47-0|2-Amino-1-(4-nitrophenyl)ethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Amino-1-(4-nitrophenyl)ethanol |
|---|
| CAS Number | 16428-47-0 | Molecular Weight | 182.177 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 381.0±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 184.2±25.1 °C |
|---|
Names
| Name | 2-amino-1-(4-nitrophenyl)ethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 381.0±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O3 |
|---|
| Molecular Weight | 182.177 |
|---|
| Flash Point | 184.2±25.1 °C |
|---|
| Exact Mass | 182.069138 |
|---|
| PSA | 92.07000 |
|---|
| LogP | 0.19 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.614 |
|---|
| InChIKey | DZOWZBGCZPHHLM-UHFFFAOYSA-N |
|---|
| SMILES | NCC(O)c1ccc([N+](=O)[O-])cc1 |
|---|
Synonyms
| 2-Amino-1-(4-nitrophenyl)ethanol |
| 2-Hydroxy-2-(4-nitrophenyl)ethylamine |
| 2-Amino-1-(4-nitro-phenyl)-ethanol |
| Benzenemethanol, α-(aminomethyl)-4-nitro- |
| 2-Amino-1-(4-nitrophenyl)ethanol HCl |
| (+-) 2-Amino-1-(4-nitro-phenyl)-aethanol |
| 2-amino-1-(p-nitrophenyl)ethanol |
| 2-(4-nitrophenyl)-2-hydroxyethylamine |
