Introduction：Basic information about CAS 139143-09-2|1,3-diisopropylimidazol-1-ium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-diisopropylimidazol-1-ium chloride |
|---|
| CAS Number | 139143-09-2 | Molecular Weight | 188.698 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9H17ClN2 | Melting Point | 278ºC (dec.)(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1,3-Diisopropylimidazolium chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 278ºC (dec.)(lit.) |
|---|
| Molecular Formula | C9H17ClN2 |
|---|
| Molecular Weight | 188.698 |
|---|
| Exact Mass | 188.108032 |
|---|
| PSA | 8.81000 |
|---|
| InChIKey | DOFXKPAOJLLPII-UHFFFAOYSA-M |
|---|
| SMILES | CC(C)n1cc[n+](C(C)C)c1.[Cl-] |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3.0 |
|---|
| HS Code | 2933290090 |
|---|
Customs
| HS Code | 2933290090 |
|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,3-di(propan-2-yl)imidazol-1-ium,chloride |
| MFCD03840577 |
| T5K CNJ AY1&1 CY1&1 &&Chloride |
| 1,3-diisopropylimidazol-1-ium chloride |
| 1,3-Bis(1-methylethyl)-1H-imidazolium, chloride (1:1) |
| 1,3-Diisopropyl-1H-imidazol-3-ium chloride |
| 1H-Imidazolium, 1,3-bis(1-methylethyl)-, chloride (1:1) |
