Introduction：Basic information about CAS 16403-84-2|4-[(5-carbamoyl-o-tolyl)azo]-3-hydroxynaphth-2-anilide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(5-carbamoyl-o-tolyl)azo]-3-hydroxynaphth-2-anilide |
|---|
| CAS Number | 16403-84-2 | Molecular Weight | 424.45100 |
|---|
| Density | 1.31 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C25H20N4O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (4Z)-4-[(5-carbamoyl-2-methylphenyl)hydrazinylidene]-3-oxo-N-phenylnaphthalene-2-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.31 g/cm3 |
|---|
| Molecular Formula | C25H20N4O3 |
|---|
| Molecular Weight | 424.45100 |
|---|
| Exact Mass | 424.15400 |
|---|
| PSA | 117.14000 |
|---|
| LogP | 6.39370 |
|---|
| Index of Refraction | 1.674 |
|---|
| InChIKey | YOGMQHMXNSEDLV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(N)=O)cc1N=Nc1c(O)c(C(=O)Nc2ccccc2)cc2ccccc12 |
|---|
