Introduction：Basic information about CAS 312619-46-8|n-(tert-butoxycarbonyl)-3-(4-(1-pyrrolyl)phenyl)-l-alanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | n-(tert-butoxycarbonyl)-3-(4-(1-pyrrolyl)phenyl)-l-alanine |
|---|
| CAS Number | 312619-46-8 | Molecular Weight | 330.37800 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 513.7ºC at 760mmHg |
|---|
| Molecular Formula | C18H22N2O4 | Melting Point | 85ºC(lit.) |
|---|
| MSDS | / | Flash Point | 264.5ºC |
|---|
Names
| Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-pyrrol-1-ylphenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 513.7ºC at 760mmHg |
|---|
| Melting Point | 85ºC(lit.) |
|---|
| Molecular Formula | C18H22N2O4 |
|---|
| Molecular Weight | 330.37800 |
|---|
| Flash Point | 264.5ºC |
|---|
| Exact Mass | 330.15800 |
|---|
| PSA | 80.56000 |
|---|
| LogP | 3.38860 |
|---|
| Index of Refraction | 1.561 |
|---|
| InChIKey | FUNJWWBPGJDLMT-HNNXBMFYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(-n2cccc2)cc1)C(=O)O |
|---|
Synonyms
| boc-4-(1-pyrrolyl)-Phe-OH |
| 4-Pyroyl-(N-tert-butyloxycarbonylamino)-L-phenyl alanine |
