Introduction：Basic information about CAS 618-88-2|5-Nitroisophthalic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Nitroisophthalic acid |
|---|
| CAS Number | 618-88-2 | Molecular Weight | 211.128 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 473.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H5NO6 | Melting Point | 259-261 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 213.9±15.8 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 5-Nitroisophthalic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 473.7±40.0 °C at 760 mmHg |
|---|
| Melting Point | 259-261 °C(lit.) |
|---|
| Molecular Formula | C8H5NO6 |
|---|
| Molecular Weight | 211.128 |
|---|
| Flash Point | 213.9±15.8 °C |
|---|
| Exact Mass | 211.011688 |
|---|
| PSA | 120.42000 |
|---|
| LogP | 1.79 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.660 |
|---|
| InChIKey | NBDAHKQJXVLAID-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(C(=O)O)cc([N+](=O)[O-])c1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | 2811 |
|---|
| WGK Germany | 3 |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2917399090 |
|---|
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 5-nitro-1,3-benzenedicarboxylate |
| 1,3-Benzenedicarboxylic acid, 5-nitro- |
| 5-nitro-1,3-benzenedicarboxylic acid |
| EINECS 210-568-3 |
| 5itroIsophathalicAcid |
| 5-NIPA |
| 3-Carboxy-5-nitrobenzoic acid |
| 5-NO2-isophthalic acid |
| 5-Nitro-m-phthalic acid |
| 5-nitrobenzene-1,3-dicarboxylic acid |
| 5-Nitroisophthalic acid |
| 5-Nitroisophthalic a |
| NITRO ISOPHTHALIC ACID |
| NITROISOPHTHALIC-5 ACID |
| MFCD00007254 |
| 5-Nitroisophthalicacid |
